C22H26FN5O3 — CID 57415108
tert-butyl 4-[7-(6-fluoro-3-pyridinyl)-5-methylpyrrolo[3,2-d]pyrimidin-4-yl]oxypiperidine-1-carboxylate (PubChem CID 57415108) has the molecular formula C22H26FN5O3 and a molecular weight of 427.48 g/mol. Its IUPAC name is tert-butyl 4-[7-(6-fluoro-3-pyridinyl)-5-methylpyrrolo[3,2-d]pyrimidin-4-yl]oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[7-(6-fluoro-3-pyridinyl)-5-methylpyrrolo[3,2-d]pyrimidin-4-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 57415108 |
| Molecular Formula | C22H26FN5O3 |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | tert-butyl 4-[7-(6-fluoro-3-pyridinyl)-5-methylpyrrolo[3,2-d]pyrimidin-4-yl]oxypiperidine-1-carboxylate |
| SMILES | Cn1cc(-c2ccc(F)nc2)c2ncnc(OC3CCN(C(=O)OC(C)(C)C)CC3)c21 |
| InChI | InChI=1S/C22H26FN5O3/c1-22(2,3)31-21(29)28-9-7-15(8-10-28)30-20-19-18(25-13-26-20)16(12-27(19)4)14-5-6-17(23)24-11-14/h5-6,11-13,15H,7-10H2,1-4H3 |
| InChIKey | OWTLFALAKQUCHE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|