C14H16Br2O4 — CID 57415111
2,4-dibromo-5-[(5,5-dimethyl-1,3-dioxan-2-yl)methoxy]benzaldehyde (PubChem CID 57415111) has the molecular formula C14H16Br2O4 and a molecular weight of 408.09 g/mol. Its IUPAC name is 2,4-dibromo-5-[(5,5-dimethyl-1,3-dioxan-2-yl)methoxy]benzaldehyde.
| Compound Name | 2,4-dibromo-5-[(5,5-dimethyl-1,3-dioxan-2-yl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 57415111 |
| Molecular Formula | C14H16Br2O4 |
| Molecular Weight | 408.09 g/mol |
| Exact Mass | 405.94 |
| IUPAC Name | 2,4-dibromo-5-[(5,5-dimethyl-1,3-dioxan-2-yl)methoxy]benzaldehyde |
| SMILES | CC1(C)COC(COc2cc(C=O)c(Br)cc2Br)OC1 |
| InChI | InChI=1S/C14H16Br2O4/c1-14(2)7-19-13(20-8-14)6-18-12-3-9(5-17)10(15)4-11(12)16/h3-5,13H,6-8H2,1-2H3 |
| InChIKey | UFEYRJAHVSTRHT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.09 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|