C17H17FN4OS — CID 57415118
(4aS,5R,7aS)-7a-(2-fluoro-5-pyrimidin-5-ylphenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine (PubChem CID 57415118) has the molecular formula C17H17FN4OS and a molecular weight of 344.42 g/mol. Its IUPAC name is (4aS,5R,7aS)-7a-(2-fluoro-5-pyrimidin-5-ylphenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aS,5R,7aS)-7a-(2-fluoro-5-pyrimidin-5-ylphenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 57415118 |
| Molecular Formula | C17H17FN4OS |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (4aS,5R,7aS)-7a-(2-fluoro-5-pyrimidin-5-ylphenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine |
| SMILES | C[C@H]1OC[C@]2(c3cc(-c4cncnc4)ccc3F)N=C(N)SC[C@H]12 |
| InChI | InChI=1S/C17H17FN4OS/c1-10-14-7-24-16(19)22-17(14,8-23-10)13-4-11(2-3-15(13)18)12-5-20-9-21-6-12/h2-6,9-10,14H,7-8H2,1H3,(H2,19,22)/t10-,14-,17-/m1/s1 |
| InChIKey | VABXEGDYXSEZSR-LGFNAOKASA-N |
| XLogP | 2.57 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |