C19H19FN2OS — CID 57415245
(4aS,5R,7aS)-7a-(2-fluoro-5-phenylphenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine (PubChem CID 57415245) has the molecular formula C19H19FN2OS and a molecular weight of 342.44 g/mol. Its IUPAC name is (4aS,5R,7aS)-7a-(2-fluoro-5-phenylphenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aS,5R,7aS)-7a-(2-fluoro-5-phenylphenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 57415245 |
| Molecular Formula | C19H19FN2OS |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (4aS,5R,7aS)-7a-(2-fluoro-5-phenylphenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine |
| SMILES | C[C@H]1OC[C@]2(c3cc(-c4ccccc4)ccc3F)N=C(N)SC[C@H]12 |
| InChI | InChI=1S/C19H19FN2OS/c1-12-16-10-24-18(21)22-19(16,11-23-12)15-9-14(7-8-17(15)20)13-5-3-2-4-6-13/h2-9,12,16H,10-11H2,1H3,(H2,21,22)/t12-,16-,19-/m1/s1 |
| InChIKey | RHVMGOVOCZGRSG-SMNXXWJPSA-N |
| XLogP | 3.78 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |