C19H18F2N2OS — CID 57415246
(4aS,5R,7aS)-7a-[2-fluoro-5-(2-fluorophenyl)phenyl]-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine (PubChem CID 57415246) has the molecular formula C19H18F2N2OS and a molecular weight of 360.43 g/mol. Its IUPAC name is (4aS,5R,7aS)-7a-[2-fluoro-5-(2-fluorophenyl)phenyl]-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aS,5R,7aS)-7a-[2-fluoro-5-(2-fluorophenyl)phenyl]-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 57415246 |
| Molecular Formula | C19H18F2N2OS |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (4aS,5R,7aS)-7a-[2-fluoro-5-(2-fluorophenyl)phenyl]-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine |
| SMILES | C[C@H]1OC[C@]2(c3cc(-c4ccccc4F)ccc3F)N=C(N)SC[C@H]12 |
| InChI | InChI=1S/C19H18F2N2OS/c1-11-15-9-25-18(22)23-19(15,10-24-11)14-8-12(6-7-17(14)21)13-4-2-3-5-16(13)20/h2-8,11,15H,9-10H2,1H3,(H2,22,23)/t11-,15-,19-/m1/s1 |
| InChIKey | OEWKQKAXBPGBSW-PRIMNGNOSA-N |
| XLogP | 3.92 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |