C18H17F2N3OS — CID 57415247
(4aS,5R,7aS)-7a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine (PubChem CID 57415247) has the molecular formula C18H17F2N3OS and a molecular weight of 361.42 g/mol. Its IUPAC name is (4aS,5R,7aS)-7a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aS,5R,7aS)-7a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 57415247 |
| Molecular Formula | C18H17F2N3OS |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (4aS,5R,7aS)-7a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine |
| SMILES | C[C@H]1OC[C@]2(c3cc(-c4cccnc4F)ccc3F)N=C(N)SC[C@H]12 |
| InChI | InChI=1S/C18H17F2N3OS/c1-10-14-8-25-17(21)23-18(14,9-24-10)13-7-11(4-5-15(13)19)12-3-2-6-22-16(12)20/h2-7,10,14H,8-9H2,1H3,(H2,21,23)/t10-,14-,18-/m1/s1 |
| InChIKey | QFTYJYGAVMXGCG-MAZCYNQFSA-N |
| XLogP | 3.32 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|