C19H20FN3O2S — CID 57415614
(4aS,5R,7aS)-7a-[2-fluoro-5-(6-methoxy-2-pyridinyl)phenyl]-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine (PubChem CID 57415614) has the molecular formula C19H20FN3O2S and a molecular weight of 373.45 g/mol. Its IUPAC name is (4aS,5R,7aS)-7a-[2-fluoro-5-(6-methoxy-2-pyridinyl)phenyl]-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aS,5R,7aS)-7a-[2-fluoro-5-(6-methoxy-2-pyridinyl)phenyl]-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 57415614 |
| Molecular Formula | C19H20FN3O2S |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (4aS,5R,7aS)-7a-[2-fluoro-5-(6-methoxy-2-pyridinyl)phenyl]-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine |
| SMILES | COc1cccc(-c2ccc(F)c([C@]34CO[C@H](C)[C@H]3CSC(N)=N4)c2)n1 |
| InChI | InChI=1S/C19H20FN3O2S/c1-11-14-9-26-18(21)23-19(14,10-25-11)13-8-12(6-7-15(13)20)16-4-3-5-17(22-16)24-2/h3-8,11,14H,9-10H2,1-2H3,(H2,21,23)/t11-,14-,19-/m1/s1 |
| InChIKey | SESSRQRGVGGUOX-FRGNPEFRSA-N |
| XLogP | 3.19 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |