C14H19ClN6 — CID 57415651
1-(6-amino-3-pyridinyl)-2-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-cyanoguanidine;hydrochloride (PubChem CID 57415651) has the molecular formula C14H19ClN6 and a molecular weight of 306.80 g/mol. Its IUPAC name is 1-(6-amino-3-pyridinyl)-2-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-cyanoguanidine;hydrochloride.
| Compound Name | 1-(6-amino-3-pyridinyl)-2-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-cyanoguanidine;hydrochloride |
|---|---|
| PubChem CID | 57415651 |
| Molecular Formula | C14H19ClN6 |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-(6-amino-3-pyridinyl)-2-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-cyanoguanidine;hydrochloride |
| SMILES | Cl.N#CN/C(=N\[C@@H]1C[C@@H]2CC[C@H]1C2)Nc1ccc(N)nc1 |
| InChI | InChI=1S/C14H18N6.ClH/c15-8-18-14(19-11-3-4-13(16)17-7-11)20-12-6-9-1-2-10(12)5-9;/h3-4,7,9-10,12H,1-2,5-6H2,(H2,16,17)(H2,18,19,20);1H/t9-,10+,12-;/m1./s1 |
| InChIKey | ZIVGNHQBUJFAOF-QQQUOLKDSA-N |
| XLogP | 2.11 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|