methyl 1H-pyrazolo[3,4-b]pyridine-5-carboxylate

C8H7N3O2 — CID 57415679

IUPACmethyl 1H-pyrazolo[3,4-b]pyridine-5-carboxylate
SMILESCOC(=O)c1cnc2[nH]ncc2c1
InChIInChI=1S/C8H7N3O2/c1-13-8(12)6-2-5-4-10-11-7(5)9-3-6/h2-4H,1H3,(H,9,10,11)
InChIKeyWAYSJYROSIMXRC-UHFFFAOYSA-N
MW177.16 g/mol
LogP0.74
Rot. Bonds1

About methyl 1H-pyrazolo[3,4-b]pyridine-5-carboxylate

methyl 1H-pyrazolo[3,4-b]pyridine-5-carboxylate (PubChem CID 57415679) has the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. Its IUPAC name is methyl 1H-pyrazolo[3,4-b]pyridine-5-carboxylate.

Molecular Properties

Compound Namemethyl 1H-pyrazolo[3,4-b]pyridine-5-carboxylate
PubChem CID57415679
Molecular FormulaC8H7N3O2
Molecular Weight177.16 g/mol
Exact Mass177.05
IUPAC Namemethyl 1H-pyrazolo[3,4-b]pyridine-5-carboxylate
SMILESCOC(=O)c1cnc2[nH]ncc2c1
InChIInChI=1S/C8H7N3O2/c1-13-8(12)6-2-5-4-10-11-7(5)9-3-6/h2-4H,1H3,(H,9,10,11)
InChIKeyWAYSJYROSIMXRC-UHFFFAOYSA-N
XLogP0.74
TPSA67.87 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.16
LogP ≤ 50.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 1H-pyrazolo[3,4-b]pyridine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1H-pyrazolo[3,4-b]pyridine-5-carboxylate?
The IUPAC name of methyl 1H-pyrazolo[3,4-b]pyridine-5-carboxylate (CID 57415679) is methyl 1H-pyrazolo[3,4-b]pyridine-5-carboxylate.
What is the SMILES notation for methyl 1H-pyrazolo[3,4-b]pyridine-5-carboxylate?
The canonical SMILES for methyl 1H-pyrazolo[3,4-b]pyridine-5-carboxylate is COC(=O)c1cnc2[nH]ncc2c1.
What is the InChIKey of methyl 1H-pyrazolo[3,4-b]pyridine-5-carboxylate?
The InChIKey is WAYSJYROSIMXRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c1-13-8(12)6-2-5-4-10-11-7(5)9-3-6/h2-4H,1H3,(H,9,10,11).
What are the key properties of methyl 1H-pyrazolo[3,4-b]pyridine-5-carboxylate?
methyl 1H-pyrazolo[3,4-b]pyridine-5-carboxylate has a molecular weight of 177.16 g/mol, XLogP of 0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1H-pyrazolo[3,4-b]pyridine-5-carboxylate is sourced from PubChem (CID 57415679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).