About 2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine
2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 57415902) has the molecular formula C6H2Cl2IN3
and a molecular weight of 313.91 g/mol. Its IUPAC name is 2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 57415902 |
| Molecular Formula | C6H2Cl2IN3 |
| Molecular Weight | 313.91 g/mol |
| Exact Mass | 312.87 |
| IUPAC Name | 2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | Clc1nc(Cl)c2c(I)c[nH]c2n1 |
| InChI | InChI=1S/C6H2Cl2IN3/c7-4-3-2(9)1-10-5(3)12-6(8)11-4/h1H,(H,10,11,12) |
| InChIKey | RIRSSBIXHXMTLS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.91 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine (CID 57415902) is 2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine is Clc1nc(Cl)c2c(I)c[nH]c2n1.
What is the InChIKey of 2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is RIRSSBIXHXMTLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Cl2IN3/c7-4-3-2(9)1-10-5(3)12-6(8)11-4/h1H,(H,10,11,12).
What are the key properties of 2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine?
2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine has a molecular weight of 313.91 g/mol, XLogP of 2.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 57415902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).