About 5-amino-1-propan-2-yl-3,4-dihydroquinazolin-2-one
5-amino-1-propan-2-yl-3,4-dihydroquinazolin-2-one (PubChem CID 57415940) has the molecular formula C11H15N3O
and a molecular weight of 205.26 g/mol. Its IUPAC name is 5-amino-1-propan-2-yl-3,4-dihydroquinazolin-2-one.
Molecular Properties
| Compound Name | 5-amino-1-propan-2-yl-3,4-dihydroquinazolin-2-one |
| PubChem CID | 57415940 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 5-amino-1-propan-2-yl-3,4-dihydroquinazolin-2-one |
| SMILES | CC(C)N1C(=O)NCc2c(N)cccc21 |
| InChI | InChI=1S/C11H15N3O/c1-7(2)14-10-5-3-4-9(12)8(10)6-13-11(14)15/h3-5,7H,6,12H2,1-2H3,(H,13,15) |
| InChIKey | DRNDCEYQANMYAY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1-propan-2-yl-3,4-dihydroquinazolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-propan-2-yl-3,4-dihydroquinazolin-2-one?
The IUPAC name of 5-amino-1-propan-2-yl-3,4-dihydroquinazolin-2-one (CID 57415940) is 5-amino-1-propan-2-yl-3,4-dihydroquinazolin-2-one.
What is the SMILES notation for 5-amino-1-propan-2-yl-3,4-dihydroquinazolin-2-one?
The canonical SMILES for 5-amino-1-propan-2-yl-3,4-dihydroquinazolin-2-one is CC(C)N1C(=O)NCc2c(N)cccc21.
What is the InChIKey of 5-amino-1-propan-2-yl-3,4-dihydroquinazolin-2-one?
The InChIKey is DRNDCEYQANMYAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O/c1-7(2)14-10-5-3-4-9(12)8(10)6-13-11(14)15/h3-5,7H,6,12H2,1-2H3,(H,13,15).
What are the key properties of 5-amino-1-propan-2-yl-3,4-dihydroquinazolin-2-one?
5-amino-1-propan-2-yl-3,4-dihydroquinazolin-2-one has a molecular weight of 205.26 g/mol, XLogP of 1.71, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-propan-2-yl-3,4-dihydroquinazolin-2-one is sourced from PubChem (CID 57415940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).