About 2-methylsulfanyl-7-pyrazin-2-ylpyrrolo[2,1-f][1,2,4]triazine
2-methylsulfanyl-7-pyrazin-2-ylpyrrolo[2,1-f][1,2,4]triazine (PubChem CID 57416125) has the molecular formula C11H9N5S
and a molecular weight of 243.30 g/mol. Its IUPAC name is 2-methylsulfanyl-7-pyrazin-2-ylpyrrolo[2,1-f][1,2,4]triazine.
Molecular Properties
| Compound Name | 2-methylsulfanyl-7-pyrazin-2-ylpyrrolo[2,1-f][1,2,4]triazine |
| PubChem CID | 57416125 |
| Molecular Formula | C11H9N5S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-methylsulfanyl-7-pyrazin-2-ylpyrrolo[2,1-f][1,2,4]triazine |
| SMILES | CSc1ncc2ccc(-c3cnccn3)n2n1 |
| InChI | InChI=1S/C11H9N5S/c1-17-11-14-6-8-2-3-10(16(8)15-11)9-7-12-4-5-13-9/h2-7H,1H3 |
| InChIKey | KMNSKURWPZVVMS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methylsulfanyl-7-pyrazin-2-ylpyrrolo[2,1-f][1,2,4]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-7-pyrazin-2-ylpyrrolo[2,1-f][1,2,4]triazine?
The IUPAC name of 2-methylsulfanyl-7-pyrazin-2-ylpyrrolo[2,1-f][1,2,4]triazine (CID 57416125) is 2-methylsulfanyl-7-pyrazin-2-ylpyrrolo[2,1-f][1,2,4]triazine.
What is the SMILES notation for 2-methylsulfanyl-7-pyrazin-2-ylpyrrolo[2,1-f][1,2,4]triazine?
The canonical SMILES for 2-methylsulfanyl-7-pyrazin-2-ylpyrrolo[2,1-f][1,2,4]triazine is CSc1ncc2ccc(-c3cnccn3)n2n1.
What is the InChIKey of 2-methylsulfanyl-7-pyrazin-2-ylpyrrolo[2,1-f][1,2,4]triazine?
The InChIKey is KMNSKURWPZVVMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5S/c1-17-11-14-6-8-2-3-10(16(8)15-11)9-7-12-4-5-13-9/h2-7H,1H3.
What are the key properties of 2-methylsulfanyl-7-pyrazin-2-ylpyrrolo[2,1-f][1,2,4]triazine?
2-methylsulfanyl-7-pyrazin-2-ylpyrrolo[2,1-f][1,2,4]triazine has a molecular weight of 243.30 g/mol, XLogP of 1.91, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-7-pyrazin-2-ylpyrrolo[2,1-f][1,2,4]triazine is sourced from PubChem (CID 57416125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).