C13H25BO2 — CID 57416203
2-hept-1-en-3-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 57416203) has the molecular formula C13H25BO2 and a molecular weight of 224.15 g/mol. Its IUPAC name is 2-hept-1-en-3-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-hept-1-en-3-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 57416203 |
| Molecular Formula | C13H25BO2 |
| Molecular Weight | 224.15 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 2-hept-1-en-3-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=CC(CCCC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H25BO2/c1-7-9-10-11(8-2)14-15-12(3,4)13(5,6)16-14/h8,11H,2,7,9-10H2,1,3-6H3 |
| InChIKey | FFFJDCLYFUSLKA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.15 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|