C14H24BNO4Si — CID 57416416
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-trimethylsilyl-1,2-oxazol-3-yl]ethanone (PubChem CID 57416416) has the molecular formula C14H24BNO4Si and a molecular weight of 309.25 g/mol. Its IUPAC name is 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-trimethylsilyl-1,2-oxazol-3-yl]ethanone.
| Compound Name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-trimethylsilyl-1,2-oxazol-3-yl]ethanone |
|---|---|
| PubChem CID | 57416416 |
| Molecular Formula | C14H24BNO4Si |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-trimethylsilyl-1,2-oxazol-3-yl]ethanone |
| SMILES | CC(=O)c1noc([Si](C)(C)C)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H24BNO4Si/c1-9(17)11-10(12(18-16-11)21(6,7)8)15-19-13(2,3)14(4,5)20-15/h1-8H3 |
| InChIKey | BAJRFOUUFNFAJX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|