C15H23BN2O2 — CID 57416764
5,6-dimethyl-3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-2-amine (PubChem CID 57416764) has the molecular formula C15H23BN2O2 and a molecular weight of 274.17 g/mol. Its IUPAC name is 5,6-dimethyl-3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-2-amine.
| Compound Name | 5,6-dimethyl-3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 57416764 |
| Molecular Formula | C15H23BN2O2 |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 5,6-dimethyl-3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-2-amine |
| SMILES | Cc1cc(/C=C/B2OC(C)(C)C(C)(C)O2)c(N)nc1C |
| InChI | InChI=1S/C15H23BN2O2/c1-10-9-12(13(17)18-11(10)2)7-8-16-19-14(3,4)15(5,6)20-16/h7-9H,1-6H3,(H2,17,18)/b8-7+ |
| InChIKey | CSLLEIKYFGSXOZ-BQYQJAHWSA-N |
| XLogP | 2.93 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|