About 6-ethenylpyrido[2,3-b]pyrazine
6-ethenylpyrido[2,3-b]pyrazine (PubChem CID 57416844) has the molecular formula C9H7N3
and a molecular weight of 157.18 g/mol. Its IUPAC name is 6-ethenylpyrido[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 6-ethenylpyrido[2,3-b]pyrazine |
| PubChem CID | 57416844 |
| Molecular Formula | C9H7N3 |
| Molecular Weight | 157.18 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 6-ethenylpyrido[2,3-b]pyrazine |
| SMILES | C=Cc1ccc2nccnc2n1 |
| InChI | InChI=1S/C9H7N3/c1-2-7-3-4-8-9(12-7)11-6-5-10-8/h2-6H,1H2 |
| InChIKey | PRWYUXWVDCSPQR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethenylpyrido[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenylpyrido[2,3-b]pyrazine?
The IUPAC name of 6-ethenylpyrido[2,3-b]pyrazine (CID 57416844) is 6-ethenylpyrido[2,3-b]pyrazine.
What is the SMILES notation for 6-ethenylpyrido[2,3-b]pyrazine?
The canonical SMILES for 6-ethenylpyrido[2,3-b]pyrazine is C=Cc1ccc2nccnc2n1.
What is the InChIKey of 6-ethenylpyrido[2,3-b]pyrazine?
The InChIKey is PRWYUXWVDCSPQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3/c1-2-7-3-4-8-9(12-7)11-6-5-10-8/h2-6H,1H2.
What are the key properties of 6-ethenylpyrido[2,3-b]pyrazine?
6-ethenylpyrido[2,3-b]pyrazine has a molecular weight of 157.18 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenylpyrido[2,3-b]pyrazine is sourced from PubChem (CID 57416844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).