About [2-[dimethyl-(2,4,6-trimethylphenyl)silyl]phenyl]methanol
[2-[dimethyl-(2,4,6-trimethylphenyl)silyl]phenyl]methanol (PubChem CID 57416884) has the molecular formula C18H24OSi
and a molecular weight of 284.48 g/mol. Its IUPAC name is [2-[dimethyl-(2,4,6-trimethylphenyl)silyl]phenyl]methanol.
Molecular Properties
| Compound Name | [2-[dimethyl-(2,4,6-trimethylphenyl)silyl]phenyl]methanol |
| PubChem CID | 57416884 |
| Molecular Formula | C18H24OSi |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | [2-[dimethyl-(2,4,6-trimethylphenyl)silyl]phenyl]methanol |
| SMILES | Cc1cc(C)c([Si](C)(C)c2ccccc2CO)c(C)c1 |
| InChI | InChI=1S/C18H24OSi/c1-13-10-14(2)18(15(3)11-13)20(4,5)17-9-7-6-8-16(17)12-19/h6-11,19H,12H2,1-5H3 |
| InChIKey | SZEWDPYNFNJUHJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-[dimethyl-(2,4,6-trimethylphenyl)silyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[dimethyl-(2,4,6-trimethylphenyl)silyl]phenyl]methanol?
The IUPAC name of [2-[dimethyl-(2,4,6-trimethylphenyl)silyl]phenyl]methanol (CID 57416884) is [2-[dimethyl-(2,4,6-trimethylphenyl)silyl]phenyl]methanol.
What is the SMILES notation for [2-[dimethyl-(2,4,6-trimethylphenyl)silyl]phenyl]methanol?
The canonical SMILES for [2-[dimethyl-(2,4,6-trimethylphenyl)silyl]phenyl]methanol is Cc1cc(C)c([Si](C)(C)c2ccccc2CO)c(C)c1.
What is the InChIKey of [2-[dimethyl-(2,4,6-trimethylphenyl)silyl]phenyl]methanol?
The InChIKey is SZEWDPYNFNJUHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24OSi/c1-13-10-14(2)18(15(3)11-13)20(4,5)17-9-7-6-8-16(17)12-19/h6-11,19H,12H2,1-5H3.
What are the key properties of [2-[dimethyl-(2,4,6-trimethylphenyl)silyl]phenyl]methanol?
[2-[dimethyl-(2,4,6-trimethylphenyl)silyl]phenyl]methanol has a molecular weight of 284.48 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[dimethyl-(2,4,6-trimethylphenyl)silyl]phenyl]methanol is sourced from PubChem (CID 57416884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).