About CID 57417106
CID 57417106 (PubChem CID 57417106) has the molecular formula C5H5N2O2
and a molecular weight of 125.11 g/mol.
Molecular Properties
| Compound Name | CID 57417106 |
| PubChem CID | 57417106 |
| Molecular Formula | C5H5N2O2 |
| Molecular Weight | 125.11 g/mol |
| Exact Mass | 125.04 |
| IUPAC Name | — |
| SMILES | Cc1cnc([O])[nH]c1=O |
| InChI | InChI=1S/C5H5N2O2/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H,6,7,8) |
| InChIKey | NMMMHGDALYOWTG-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 65.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.11 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 57417106 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57417106?
The IUPAC name of CID 57417106 (CID 57417106) is not available.
What is the SMILES notation for CID 57417106?
The canonical SMILES for CID 57417106 is Cc1cnc([O])[nH]c1=O.
What is the InChIKey of CID 57417106?
The InChIKey is NMMMHGDALYOWTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N2O2/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H,6,7,8).
What are the key properties of CID 57417106?
CID 57417106 has a molecular weight of 125.11 g/mol, XLogP of 0.22, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57417106 is sourced from PubChem (CID 57417106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).