About CID 57417136
CID 57417136 (PubChem CID 57417136) has the molecular formula C7H6F
and a molecular weight of 109.12 g/mol.
Molecular Properties
| Compound Name | CID 57417136 |
| PubChem CID | 57417136 |
| Molecular Formula | C7H6F |
| Molecular Weight | 109.12 g/mol |
| Exact Mass | 109.05 |
| IUPAC Name | — |
| SMILES | Cc1[c]cccc1F |
| InChI | InChI=1S/C7H6F/c1-6-4-2-3-5-7(6)8/h2-3,5H,1H3 |
| InChIKey | FSQMHSXEEJXTJJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.12 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 57417136 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57417136?
The IUPAC name of CID 57417136 (CID 57417136) is not available.
What is the SMILES notation for CID 57417136?
The canonical SMILES for CID 57417136 is Cc1[c]cccc1F.
What is the InChIKey of CID 57417136?
The InChIKey is FSQMHSXEEJXTJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F/c1-6-4-2-3-5-7(6)8/h2-3,5H,1H3.
What are the key properties of CID 57417136?
CID 57417136 has a molecular weight of 109.12 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57417136 is sourced from PubChem (CID 57417136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).