About pyrazolo[3,4-c]quinolin-4-one
pyrazolo[3,4-c]quinolin-4-one (PubChem CID 57417572) has the molecular formula C10H5N3O
and a molecular weight of 183.17 g/mol. Its IUPAC name is pyrazolo[3,4-c]quinolin-4-one.
Molecular Properties
| Compound Name | pyrazolo[3,4-c]quinolin-4-one |
| PubChem CID | 57417572 |
| Molecular Formula | C10H5N3O |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | pyrazolo[3,4-c]quinolin-4-one |
| SMILES | O=C1N=c2ccccc2=C2C=NN=C12 |
| InChI | InChI=1S/C10H5N3O/c14-10-9-7(5-11-13-9)6-3-1-2-4-8(6)12-10/h1-5H |
| InChIKey | RBGULMQUXFAZQR-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 54.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrazolo[3,4-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazolo[3,4-c]quinolin-4-one?
The IUPAC name of pyrazolo[3,4-c]quinolin-4-one (CID 57417572) is pyrazolo[3,4-c]quinolin-4-one.
What is the SMILES notation for pyrazolo[3,4-c]quinolin-4-one?
The canonical SMILES for pyrazolo[3,4-c]quinolin-4-one is O=C1N=c2ccccc2=C2C=NN=C12.
What is the InChIKey of pyrazolo[3,4-c]quinolin-4-one?
The InChIKey is RBGULMQUXFAZQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5N3O/c14-10-9-7(5-11-13-9)6-3-1-2-4-8(6)12-10/h1-5H.
What are the key properties of pyrazolo[3,4-c]quinolin-4-one?
pyrazolo[3,4-c]quinolin-4-one has a molecular weight of 183.17 g/mol, XLogP of -0.56, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazolo[3,4-c]quinolin-4-one is sourced from PubChem (CID 57417572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).