About acetamide;hydrochloride
acetamide;hydrochloride (PubChem CID 57417608) has the molecular formula C2H6ClNO
and a molecular weight of 95.53 g/mol. Its IUPAC name is acetamide;hydrochloride.
Molecular Properties
| Compound Name | acetamide;hydrochloride |
| PubChem CID | 57417608 |
| Molecular Formula | C2H6ClNO |
| Molecular Weight | 95.53 g/mol |
| Exact Mass | 95.01 |
| IUPAC Name | acetamide;hydrochloride |
| SMILES | CC(N)=O.Cl |
| InChI | InChI=1S/C2H5NO.ClH/c1-2(3)4;/h1H3,(H2,3,4);1H |
| InChIKey | AXJDEHNQPMZKOS-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.53 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;hydrochloride?
The IUPAC name of acetamide;hydrochloride (CID 57417608) is acetamide;hydrochloride.
What is the SMILES notation for acetamide;hydrochloride?
The canonical SMILES for acetamide;hydrochloride is CC(N)=O.Cl.
What is the InChIKey of acetamide;hydrochloride?
The InChIKey is AXJDEHNQPMZKOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO.ClH/c1-2(3)4;/h1H3,(H2,3,4);1H.
What are the key properties of acetamide;hydrochloride?
acetamide;hydrochloride has a molecular weight of 95.53 g/mol, XLogP of -0.09, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;hydrochloride is sourced from PubChem (CID 57417608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).