C10H16O2 — CID 574183
2-hydroxy-4,4,6,6-tetramethylcyclohex-2-en-1-one (PubChem CID 574183) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-hydroxy-4,4,6,6-tetramethylcyclohex-2-en-1-one.
| Compound Name | 2-hydroxy-4,4,6,6-tetramethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 574183 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2-hydroxy-4,4,6,6-tetramethylcyclohex-2-en-1-one |
| SMILES | CC1(C)C=C(O)C(=O)C(C)(C)C1 |
| InChI | InChI=1S/C10H16O2/c1-9(2)5-7(11)8(12)10(3,4)6-9/h5,11H,6H2,1-4H3 |
| InChIKey | ZDVYJSLTFYQPID-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |