About 1H-inden-1-ide;iron
1H-inden-1-ide;iron (PubChem CID 57418589) has the molecular formula C9H7Fe-
and a molecular weight of 171.00 g/mol. Its IUPAC name is 1H-inden-1-ide;iron.
Molecular Properties
| Compound Name | 1H-inden-1-ide;iron |
| PubChem CID | 57418589 |
| Molecular Formula | C9H7Fe- |
| Molecular Weight | 171.00 g/mol |
| Exact Mass | 170.99 |
| IUPAC Name | 1H-inden-1-ide;iron |
| SMILES | [Fe].c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C9H7.Fe/c1-2-5-9-7-3-6-8(9)4-1;/h1-7H;/q-1; |
| InChIKey | ARSSFTTWUNZHHJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.00 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1H-inden-1-ide;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-inden-1-ide;iron?
The IUPAC name of 1H-inden-1-ide;iron (CID 57418589) is 1H-inden-1-ide;iron.
What is the SMILES notation for 1H-inden-1-ide;iron?
The canonical SMILES for 1H-inden-1-ide;iron is [Fe].c1ccc2[cH-]ccc2c1.
What is the InChIKey of 1H-inden-1-ide;iron?
The InChIKey is ARSSFTTWUNZHHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7.Fe/c1-2-5-9-7-3-6-8(9)4-1;/h1-7H;/q-1;.
What are the key properties of 1H-inden-1-ide;iron?
1H-inden-1-ide;iron has a molecular weight of 171.00 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-inden-1-ide;iron is sourced from PubChem (CID 57418589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).