About 6-bromo-5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazole
6-bromo-5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazole (PubChem CID 57418762) has the molecular formula C17H15BrF2N2O
and a molecular weight of 381.22 g/mol. Its IUPAC name is 6-bromo-5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazole.
Molecular Properties
| Compound Name | 6-bromo-5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazole |
| PubChem CID | 57418762 |
| Molecular Formula | C17H15BrF2N2O |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 6-bromo-5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazole |
| SMILES | CC(C)Cn1ncc2cc(Oc3ccc(F)cc3F)c(Br)cc21 |
| InChI | InChI=1S/C17H15BrF2N2O/c1-10(2)9-22-15-7-13(18)17(5-11(15)8-21-22)23-16-4-3-12(19)6-14(16)20/h3-8,10H,9H2,1-2H3 |
| InChIKey | ZFOHHDQMQLEKNC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazole?
The IUPAC name of 6-bromo-5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazole (CID 57418762) is 6-bromo-5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazole.
What is the SMILES notation for 6-bromo-5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazole?
The canonical SMILES for 6-bromo-5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazole is CC(C)Cn1ncc2cc(Oc3ccc(F)cc3F)c(Br)cc21.
What is the InChIKey of 6-bromo-5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazole?
The InChIKey is ZFOHHDQMQLEKNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15BrF2N2O/c1-10(2)9-22-15-7-13(18)17(5-11(15)8-21-22)23-16-4-3-12(19)6-14(16)20/h3-8,10H,9H2,1-2H3.
What are the key properties of 6-bromo-5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazole?
6-bromo-5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazole has a molecular weight of 381.22 g/mol, XLogP of 5.53, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-5-(2,4-difluorophenoxy)-1-(2-methylpropyl)indazole is sourced from PubChem (CID 57418762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).