About 6-amino-1,3-benzoxazin-2-one
6-amino-1,3-benzoxazin-2-one (PubChem CID 57419146) has the molecular formula C8H6N2O2
and a molecular weight of 162.15 g/mol. Its IUPAC name is 6-amino-1,3-benzoxazin-2-one.
Molecular Properties
| Compound Name | 6-amino-1,3-benzoxazin-2-one |
| PubChem CID | 57419146 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 6-amino-1,3-benzoxazin-2-one |
| SMILES | Nc1ccc2oc(=O)ncc2c1 |
| InChI | InChI=1S/C8H6N2O2/c9-6-1-2-7-5(3-6)4-10-8(11)12-7/h1-4H,9H2 |
| InChIKey | XNWZMKUYBVYQNM-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-1,3-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1,3-benzoxazin-2-one?
The IUPAC name of 6-amino-1,3-benzoxazin-2-one (CID 57419146) is 6-amino-1,3-benzoxazin-2-one.
What is the SMILES notation for 6-amino-1,3-benzoxazin-2-one?
The canonical SMILES for 6-amino-1,3-benzoxazin-2-one is Nc1ccc2oc(=O)ncc2c1.
What is the InChIKey of 6-amino-1,3-benzoxazin-2-one?
The InChIKey is XNWZMKUYBVYQNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2/c9-6-1-2-7-5(3-6)4-10-8(11)12-7/h1-4H,9H2.
What are the key properties of 6-amino-1,3-benzoxazin-2-one?
6-amino-1,3-benzoxazin-2-one has a molecular weight of 162.15 g/mol, XLogP of 0.77, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1,3-benzoxazin-2-one is sourced from PubChem (CID 57419146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).