About N-iminonitramide
N-iminonitramide (PubChem CID 57419430) has the molecular formula HN3O2
and a molecular weight of 75.03 g/mol. Its IUPAC name is N-iminonitramide.
Molecular Properties
| Compound Name | N-iminonitramide |
| PubChem CID | 57419430 |
| Molecular Formula | HN3O2 |
| Molecular Weight | 75.03 g/mol |
| Exact Mass | 75.01 |
| IUPAC Name | N-iminonitramide |
| SMILES | [H]/N=N/[N+](=O)[O-] |
| InChI | InChI=1S/HN3O2/c1-2-3(4)5/h1H/b2-1+ |
| InChIKey | NNXAPVADOJOXSL-OWOJBTEDSA-N |
| XLogP | 0.21 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 75.03 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-iminonitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-iminonitramide?
The IUPAC name of N-iminonitramide (CID 57419430) is N-iminonitramide.
What is the SMILES notation for N-iminonitramide?
The canonical SMILES for N-iminonitramide is [H]/N=N/[N+](=O)[O-].
What is the InChIKey of N-iminonitramide?
The InChIKey is NNXAPVADOJOXSL-OWOJBTEDSA-N. The full InChI is InChI=1S/HN3O2/c1-2-3(4)5/h1H/b2-1+.
What are the key properties of N-iminonitramide?
N-iminonitramide has a molecular weight of 75.03 g/mol, XLogP of 0.21, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-iminonitramide is sourced from PubChem (CID 57419430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).