About methyl 2-(3,5-diiodo-2-methoxyphenyl)-2-methylpropanoate
methyl 2-(3,5-diiodo-2-methoxyphenyl)-2-methylpropanoate (PubChem CID 57419460) has the molecular formula C12H14I2O3
and a molecular weight of 460.05 g/mol. Its IUPAC name is methyl 2-(3,5-diiodo-2-methoxyphenyl)-2-methylpropanoate.
Molecular Properties
| Compound Name | methyl 2-(3,5-diiodo-2-methoxyphenyl)-2-methylpropanoate |
| PubChem CID | 57419460 |
| Molecular Formula | C12H14I2O3 |
| Molecular Weight | 460.05 g/mol |
| Exact Mass | 459.90 |
| IUPAC Name | methyl 2-(3,5-diiodo-2-methoxyphenyl)-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)c1cc(I)cc(I)c1OC |
| InChI | InChI=1S/C12H14I2O3/c1-12(2,11(15)17-4)8-5-7(13)6-9(14)10(8)16-3/h5-6H,1-4H3 |
| InChIKey | BLZXYRQIMBVVLD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.05 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(3,5-diiodo-2-methoxyphenyl)-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3,5-diiodo-2-methoxyphenyl)-2-methylpropanoate?
The IUPAC name of methyl 2-(3,5-diiodo-2-methoxyphenyl)-2-methylpropanoate (CID 57419460) is methyl 2-(3,5-diiodo-2-methoxyphenyl)-2-methylpropanoate.
What is the SMILES notation for methyl 2-(3,5-diiodo-2-methoxyphenyl)-2-methylpropanoate?
The canonical SMILES for methyl 2-(3,5-diiodo-2-methoxyphenyl)-2-methylpropanoate is COC(=O)C(C)(C)c1cc(I)cc(I)c1OC.
What is the InChIKey of methyl 2-(3,5-diiodo-2-methoxyphenyl)-2-methylpropanoate?
The InChIKey is BLZXYRQIMBVVLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14I2O3/c1-12(2,11(15)17-4)8-5-7(13)6-9(14)10(8)16-3/h5-6H,1-4H3.
What are the key properties of methyl 2-(3,5-diiodo-2-methoxyphenyl)-2-methylpropanoate?
methyl 2-(3,5-diiodo-2-methoxyphenyl)-2-methylpropanoate has a molecular weight of 460.05 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,5-diiodo-2-methoxyphenyl)-2-methylpropanoate is sourced from PubChem (CID 57419460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).