About ethanol;propan-2-one
ethanol;propan-2-one (PubChem CID 57421514) has the molecular formula C7H18O3
and a molecular weight of 150.22 g/mol. Its IUPAC name is ethanol;propan-2-one.
Molecular Properties
| Compound Name | ethanol;propan-2-one |
| PubChem CID | 57421514 |
| Molecular Formula | C7H18O3 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.13 |
| IUPAC Name | ethanol;propan-2-one |
| SMILES | CC(C)=O.CCO.CCO |
| InChI | InChI=1S/C3H6O.2C2H6O/c1-3(2)4;2*1-2-3/h1-2H3;2*3H,2H2,1H3 |
| InChIKey | KJPCVKMPOJVFRW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethanol;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;propan-2-one?
The IUPAC name of ethanol;propan-2-one (CID 57421514) is ethanol;propan-2-one.
What is the SMILES notation for ethanol;propan-2-one?
The canonical SMILES for ethanol;propan-2-one is CC(C)=O.CCO.CCO.
What is the InChIKey of ethanol;propan-2-one?
The InChIKey is KJPCVKMPOJVFRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.2C2H6O/c1-3(2)4;2*1-2-3/h1-2H3;2*3H,2H2,1H3.
What are the key properties of ethanol;propan-2-one?
ethanol;propan-2-one has a molecular weight of 150.22 g/mol, XLogP of 0.59, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;propan-2-one is sourced from PubChem (CID 57421514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).