About 7H-1,7-naphthyridin-6-one
7H-1,7-naphthyridin-6-one (PubChem CID 57421640) has the molecular formula C8H6N2O
and a molecular weight of 146.15 g/mol. Its IUPAC name is 7H-1,7-naphthyridin-6-one.
Molecular Properties
| Compound Name | 7H-1,7-naphthyridin-6-one |
| PubChem CID | 57421640 |
| Molecular Formula | C8H6N2O |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 7H-1,7-naphthyridin-6-one |
| SMILES | O=c1cc2cccnc2c[nH]1 |
| InChI | InChI=1S/C8H6N2O/c11-8-4-6-2-1-3-9-7(6)5-10-8/h1-5H,(H,10,11) |
| InChIKey | VEPZOWXMNLNTPJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7H-1,7-naphthyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-1,7-naphthyridin-6-one?
The IUPAC name of 7H-1,7-naphthyridin-6-one (CID 57421640) is 7H-1,7-naphthyridin-6-one.
What is the SMILES notation for 7H-1,7-naphthyridin-6-one?
The canonical SMILES for 7H-1,7-naphthyridin-6-one is O=c1cc2cccnc2c[nH]1.
What is the InChIKey of 7H-1,7-naphthyridin-6-one?
The InChIKey is VEPZOWXMNLNTPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O/c11-8-4-6-2-1-3-9-7(6)5-10-8/h1-5H,(H,10,11).
What are the key properties of 7H-1,7-naphthyridin-6-one?
7H-1,7-naphthyridin-6-one has a molecular weight of 146.15 g/mol, XLogP of 0.92, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-1,7-naphthyridin-6-one is sourced from PubChem (CID 57421640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).