About 7-ethyl-2,2,3-trimethyl-5-sulfanylidenenonanethial
7-ethyl-2,2,3-trimethyl-5-sulfanylidenenonanethial (PubChem CID 57421658) has the molecular formula C14H26S2
and a molecular weight of 258.50 g/mol. Its IUPAC name is 7-ethyl-2,2,3-trimethyl-5-sulfanylidenenonanethial.
Molecular Properties
| Compound Name | 7-ethyl-2,2,3-trimethyl-5-sulfanylidenenonanethial |
| PubChem CID | 57421658 |
| Molecular Formula | C14H26S2 |
| Molecular Weight | 258.50 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 7-ethyl-2,2,3-trimethyl-5-sulfanylidenenonanethial |
| SMILES | CCC(CC)CC(=S)CC(C)C(C)(C)C=S |
| InChI | InChI=1S/C14H26S2/c1-6-12(7-2)9-13(16)8-11(3)14(4,5)10-15/h10-12H,6-9H2,1-5H3 |
| InChIKey | IZDGUXYMQJIIRR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-ethyl-2,2,3-trimethyl-5-sulfanylidenenonanethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-2,2,3-trimethyl-5-sulfanylidenenonanethial?
The IUPAC name of 7-ethyl-2,2,3-trimethyl-5-sulfanylidenenonanethial (CID 57421658) is 7-ethyl-2,2,3-trimethyl-5-sulfanylidenenonanethial.
What is the SMILES notation for 7-ethyl-2,2,3-trimethyl-5-sulfanylidenenonanethial?
The canonical SMILES for 7-ethyl-2,2,3-trimethyl-5-sulfanylidenenonanethial is CCC(CC)CC(=S)CC(C)C(C)(C)C=S.
What is the InChIKey of 7-ethyl-2,2,3-trimethyl-5-sulfanylidenenonanethial?
The InChIKey is IZDGUXYMQJIIRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26S2/c1-6-12(7-2)9-13(16)8-11(3)14(4,5)10-15/h10-12H,6-9H2,1-5H3.
What are the key properties of 7-ethyl-2,2,3-trimethyl-5-sulfanylidenenonanethial?
7-ethyl-2,2,3-trimethyl-5-sulfanylidenenonanethial has a molecular weight of 258.50 g/mol, XLogP of 5.23, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-2,2,3-trimethyl-5-sulfanylidenenonanethial is sourced from PubChem (CID 57421658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).