About 3-ethyl-2,2-dimethyl-3-(sulfinatoamino)pentane
3-ethyl-2,2-dimethyl-3-(sulfinatoamino)pentane (PubChem CID 57421739) has the molecular formula C9H20NO2S-
and a molecular weight of 206.33 g/mol. Its IUPAC name is 3-ethyl-2,2-dimethyl-3-(sulfinatoamino)pentane.
Molecular Properties
| Compound Name | 3-ethyl-2,2-dimethyl-3-(sulfinatoamino)pentane |
| PubChem CID | 57421739 |
| Molecular Formula | C9H20NO2S- |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 3-ethyl-2,2-dimethyl-3-(sulfinatoamino)pentane |
| SMILES | CCC(CC)(NS(=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C9H21NO2S/c1-6-9(7-2,8(3,4)5)10-13(11)12/h10H,6-7H2,1-5H3,(H,11,12)/p-1 |
| InChIKey | UJPATLABYPLZIY-UHFFFAOYSA-M |
| XLogP | 1.98 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2,2-dimethyl-3-(sulfinatoamino)pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,2-dimethyl-3-(sulfinatoamino)pentane?
The IUPAC name of 3-ethyl-2,2-dimethyl-3-(sulfinatoamino)pentane (CID 57421739) is 3-ethyl-2,2-dimethyl-3-(sulfinatoamino)pentane.
What is the SMILES notation for 3-ethyl-2,2-dimethyl-3-(sulfinatoamino)pentane?
The canonical SMILES for 3-ethyl-2,2-dimethyl-3-(sulfinatoamino)pentane is CCC(CC)(NS(=O)[O-])C(C)(C)C.
What is the InChIKey of 3-ethyl-2,2-dimethyl-3-(sulfinatoamino)pentane?
The InChIKey is UJPATLABYPLZIY-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H21NO2S/c1-6-9(7-2,8(3,4)5)10-13(11)12/h10H,6-7H2,1-5H3,(H,11,12)/p-1.
What are the key properties of 3-ethyl-2,2-dimethyl-3-(sulfinatoamino)pentane?
3-ethyl-2,2-dimethyl-3-(sulfinatoamino)pentane has a molecular weight of 206.33 g/mol, XLogP of 1.98, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,2-dimethyl-3-(sulfinatoamino)pentane is sourced from PubChem (CID 57421739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).