C16H16FN5OS — CID 57422317
1-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-(2-fluorophenyl)thiourea (PubChem CID 57422317) has the molecular formula C16H16FN5OS and a molecular weight of 345.40 g/mol. Its IUPAC name is 1-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 57422317 |
| Molecular Formula | C16H16FN5OS |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-(2-fluorophenyl)thiourea |
| SMILES | Cc1noc(C)c1Cn1cc(NC(=S)Nc2ccccc2F)cn1 |
| InChI | InChI=1S/C16H16FN5OS/c1-10-13(11(2)23-21-10)9-22-8-12(7-18-22)19-16(24)20-15-6-4-3-5-14(15)17/h3-8H,9H2,1-2H3,(H2,19,20,24) |
| InChIKey | BBWRBNNWSBANPE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|