C17H16N6OS — CID 57422323
1-(2-cyanophenyl)-3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]thiourea (PubChem CID 57422323) has the molecular formula C17H16N6OS and a molecular weight of 352.42 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-(2-cyanophenyl)-3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 57422323 |
| Molecular Formula | C17H16N6OS |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 1-(2-cyanophenyl)-3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]thiourea |
| SMILES | Cc1noc(C)c1Cn1cc(NC(=S)Nc2ccccc2C#N)cn1 |
| InChI | InChI=1S/C17H16N6OS/c1-11-15(12(2)24-22-11)10-23-9-14(8-19-23)20-17(25)21-16-6-4-3-5-13(16)7-18/h3-6,8-9H,10H2,1-2H3,(H2,20,21,25) |
| InChIKey | HYGRTCVZTMSLLD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 91.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|