About 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazole-4-carbonyl azide
1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazole-4-carbonyl azide (PubChem CID 57422425) has the molecular formula C10H10N6O2
and a molecular weight of 246.23 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazole-4-carbonyl azide.
Molecular Properties
| Compound Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazole-4-carbonyl azide |
| PubChem CID | 57422425 |
| Molecular Formula | C10H10N6O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazole-4-carbonyl azide |
| SMILES | Cc1noc(C)c1Cn1cc(C(=O)N=[N+]=[N-])cn1 |
| InChI | InChI=1S/C10H10N6O2/c1-6-9(7(2)18-14-6)5-16-4-8(3-12-16)10(17)13-15-11/h3-4H,5H2,1-2H3 |
| InChIKey | ZMMQEVBPADVOTC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 109.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazole-4-carbonyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazole-4-carbonyl azide?
The IUPAC name of 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazole-4-carbonyl azide (CID 57422425) is 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazole-4-carbonyl azide.
What is the SMILES notation for 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazole-4-carbonyl azide?
The canonical SMILES for 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazole-4-carbonyl azide is Cc1noc(C)c1Cn1cc(C(=O)N=[N+]=[N-])cn1.
What is the InChIKey of 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazole-4-carbonyl azide?
The InChIKey is ZMMQEVBPADVOTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N6O2/c1-6-9(7(2)18-14-6)5-16-4-8(3-12-16)10(17)13-15-11/h3-4H,5H2,1-2H3.
What are the key properties of 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazole-4-carbonyl azide?
1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazole-4-carbonyl azide has a molecular weight of 246.23 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazole-4-carbonyl azide is sourced from PubChem (CID 57422425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).