C19H19N5O4 — CID 57422432
3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-1-[(2-hydroxyphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 57422432) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is 3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-1-[(2-hydroxyphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-1-[(2-hydroxyphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 57422432 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-1-[(2-hydroxyphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1noc(C)c1Cn1cc(N2C(=O)CN(Cc3ccccc3O)C2=O)cn1 |
| InChI | InChI=1S/C19H19N5O4/c1-12-16(13(2)28-21-12)10-23-9-15(7-20-23)24-18(26)11-22(19(24)27)8-14-5-3-4-6-17(14)25/h3-7,9,25H,8,10-11H2,1-2H3 |
| InChIKey | WFPISTVXDCJCPH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|