C20H21N5O3 — CID 57422489
3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-1-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 57422489) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-1-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-1-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 57422489 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-1-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | Cc1noc(C)c1Cn1cc(N2C(=O)CN(CCc3ccccc3)C2=O)cn1 |
| InChI | InChI=1S/C20H21N5O3/c1-14-18(15(2)28-22-14)12-24-11-17(10-21-24)25-19(26)13-23(20(25)27)9-8-16-6-4-3-5-7-16/h3-7,10-11H,8-9,12-13H2,1-2H3 |
| InChIKey | IWTNYLYQBLNFBD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 84.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|