About N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride
N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride (PubChem CID 57422578) has the molecular formula C14H14ClN3O2S
and a molecular weight of 323.81 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride |
| PubChem CID | 57422578 |
| Molecular Formula | C14H14ClN3O2S |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride |
| SMILES | COc1ccc(Nc2ncnc3ccsc23)cc1OC.Cl |
| InChI | InChI=1S/C14H13N3O2S.ClH/c1-18-11-4-3-9(7-12(11)19-2)17-14-13-10(5-6-20-13)15-8-16-14;/h3-8H,1-2H3,(H,15,16,17);1H |
| InChIKey | KIULQCMDWLFNEA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride?
The IUPAC name of N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride (CID 57422578) is N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride.
What is the SMILES notation for N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride?
The canonical SMILES for N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride is COc1ccc(Nc2ncnc3ccsc23)cc1OC.Cl.
What is the InChIKey of N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride?
The InChIKey is KIULQCMDWLFNEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2S.ClH/c1-18-11-4-3-9(7-12(11)19-2)17-14-13-10(5-6-20-13)15-8-16-14;/h3-8H,1-2H3,(H,15,16,17);1H.
What are the key properties of N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride?
N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride has a molecular weight of 323.81 g/mol, XLogP of 3.87, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride is sourced from PubChem (CID 57422578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).