About 6-{(E)-2-[4-(dimethylamino)phenyl]ethenyl}-4-(trifluoromethyl)pyrimidin-2(1H)-one
6-{(E)-2-[4-(dimethylamino)phenyl]ethenyl}-4-(trifluoromethyl)pyrimidin-2(1H)-one (PubChem CID 5742278) has the molecular formula C15H14F3N3O
and a molecular weight of 309.29 g/mol. Its IUPAC name is 4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-6-(trifluoromethyl)-1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 6-{(E)-2-[4-(dimethylamino)phenyl]ethenyl}-4-(trifluoromethyl)pyrimidin-2(1H)-one |
| PubChem CID | 5742278 |
| Molecular Formula | C15H14F3N3O |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-6-(trifluoromethyl)-1H-pyrimidin-2-one |
| SMILES | CN(C)C1=CC=C(C=C1)/C=C/C2=NC(=O)NC(=C2)C(F)(F)F |
| InChI | InChI=1S/C15H14F3N3O/c1-21(2)12-7-4-10(5-8-12)3-6-11-9-13(15(16,17)18)20-14(22)19-11/h3-9H,1-2H3,(H,19,20,22)/b6-3+ |
| InChIKey | BXUXTHMBDVRIMH-ZZXKWVIFSA-N |
| XLogP | 2.70 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | 513 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|
Analyze 6-{(E)-2-[4-(dimethylamino)phenyl]ethenyl}-4-(trifluoromethyl)pyrimidin-2(1H)-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-{(E)-2-[4-(dimethylamino)phenyl]ethenyl}-4-(trifluoromethyl)pyrimidin-2(1H)-one?
The IUPAC name of 6-{(E)-2-[4-(dimethylamino)phenyl]ethenyl}-4-(trifluoromethyl)pyrimidin-2(1H)-one (CID 5742278) is 4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-6-(trifluoromethyl)-1H-pyrimidin-2-one.
What is the SMILES notation for 6-{(E)-2-[4-(dimethylamino)phenyl]ethenyl}-4-(trifluoromethyl)pyrimidin-2(1H)-one?
The canonical SMILES for 6-{(E)-2-[4-(dimethylamino)phenyl]ethenyl}-4-(trifluoromethyl)pyrimidin-2(1H)-one is CN(C)C1=CC=C(C=C1)/C=C/C2=NC(=O)NC(=C2)C(F)(F)F.
What is the InChIKey of 6-{(E)-2-[4-(dimethylamino)phenyl]ethenyl}-4-(trifluoromethyl)pyrimidin-2(1H)-one?
The InChIKey is BXUXTHMBDVRIMH-ZZXKWVIFSA-N. The full InChI is InChI=1S/C15H14F3N3O/c1-21(2)12-7-4-10(5-8-12)3-6-11-9-13(15(16,17)18)20-14(22)19-11/h3-9H,1-2H3,(H,19,20,22)/b6-3+.
What are the key properties of 6-{(E)-2-[4-(dimethylamino)phenyl]ethenyl}-4-(trifluoromethyl)pyrimidin-2(1H)-one?
6-{(E)-2-[4-(dimethylamino)phenyl]ethenyl}-4-(trifluoromethyl)pyrimidin-2(1H)-one has a molecular weight of 309.29 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-{(E)-2-[4-(dimethylamino)phenyl]ethenyl}-4-(trifluoromethyl)pyrimidin-2(1H)-one is sourced from PubChem (CID 5742278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).