methyl 2,4-dichloro-5-hydrazinylbenzoate

C8H8Cl2N2O2 — CID 57422972

IUPACmethyl 2,4-dichloro-5-hydrazinylbenzoate
SMILESCOC(=O)c1cc(NN)c(Cl)cc1Cl
InChIInChI=1S/C8H8Cl2N2O2/c1-14-8(13)4-2-7(12-11)6(10)3-5(4)9/h2-3,12H,11H2,1H3
InChIKeyRTEZRWAORCVPKF-UHFFFAOYSA-N
MW235.07 g/mol
LogP2.07
Rot. Bonds2

About methyl 2,4-dichloro-5-hydrazinylbenzoate

methyl 2,4-dichloro-5-hydrazinylbenzoate (PubChem CID 57422972) has the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.07 g/mol. Its IUPAC name is methyl 2,4-dichloro-5-hydrazinylbenzoate.

Molecular Properties

Compound Namemethyl 2,4-dichloro-5-hydrazinylbenzoate
PubChem CID57422972
Molecular FormulaC8H8Cl2N2O2
Molecular Weight235.07 g/mol
Exact Mass234.00
IUPAC Namemethyl 2,4-dichloro-5-hydrazinylbenzoate
SMILESCOC(=O)c1cc(NN)c(Cl)cc1Cl
InChIInChI=1S/C8H8Cl2N2O2/c1-14-8(13)4-2-7(12-11)6(10)3-5(4)9/h2-3,12H,11H2,1H3
InChIKeyRTEZRWAORCVPKF-UHFFFAOYSA-N
XLogP2.07
TPSA64.35 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.07
LogP ≤ 52.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 2,4-dichloro-5-hydrazinylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,4-dichloro-5-hydrazinylbenzoate?
The IUPAC name of methyl 2,4-dichloro-5-hydrazinylbenzoate (CID 57422972) is methyl 2,4-dichloro-5-hydrazinylbenzoate.
What is the SMILES notation for methyl 2,4-dichloro-5-hydrazinylbenzoate?
The canonical SMILES for methyl 2,4-dichloro-5-hydrazinylbenzoate is COC(=O)c1cc(NN)c(Cl)cc1Cl.
What is the InChIKey of methyl 2,4-dichloro-5-hydrazinylbenzoate?
The InChIKey is RTEZRWAORCVPKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2N2O2/c1-14-8(13)4-2-7(12-11)6(10)3-5(4)9/h2-3,12H,11H2,1H3.
What are the key properties of methyl 2,4-dichloro-5-hydrazinylbenzoate?
methyl 2,4-dichloro-5-hydrazinylbenzoate has a molecular weight of 235.07 g/mol, XLogP of 2.07, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dichloro-5-hydrazinylbenzoate is sourced from PubChem (CID 57422972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).