About N-[(5-bromothiophen-2-yl)methyl]-2,4,5-trifluoroaniline
N-[(5-bromothiophen-2-yl)methyl]-2,4,5-trifluoroaniline (PubChem CID 57423164) has the molecular formula C11H7BrF3NS
and a molecular weight of 322.15 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-2,4,5-trifluoroaniline.
Molecular Properties
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-2,4,5-trifluoroaniline |
| PubChem CID | 57423164 |
| Molecular Formula | C11H7BrF3NS |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 320.94 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-2,4,5-trifluoroaniline |
| SMILES | Fc1cc(F)c(NCc2ccc(Br)s2)cc1F |
| InChI | InChI=1S/C11H7BrF3NS/c12-11-2-1-6(17-11)5-16-10-4-8(14)7(13)3-9(10)15/h1-4,16H,5H2 |
| InChIKey | LBJXTLRJYSTBQL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-bromothiophen-2-yl)methyl]-2,4,5-trifluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-bromothiophen-2-yl)methyl]-2,4,5-trifluoroaniline?
The IUPAC name of N-[(5-bromothiophen-2-yl)methyl]-2,4,5-trifluoroaniline (CID 57423164) is N-[(5-bromothiophen-2-yl)methyl]-2,4,5-trifluoroaniline.
What is the SMILES notation for N-[(5-bromothiophen-2-yl)methyl]-2,4,5-trifluoroaniline?
The canonical SMILES for N-[(5-bromothiophen-2-yl)methyl]-2,4,5-trifluoroaniline is Fc1cc(F)c(NCc2ccc(Br)s2)cc1F.
What is the InChIKey of N-[(5-bromothiophen-2-yl)methyl]-2,4,5-trifluoroaniline?
The InChIKey is LBJXTLRJYSTBQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrF3NS/c12-11-2-1-6(17-11)5-16-10-4-8(14)7(13)3-9(10)15/h1-4,16H,5H2.
What are the key properties of N-[(5-bromothiophen-2-yl)methyl]-2,4,5-trifluoroaniline?
N-[(5-bromothiophen-2-yl)methyl]-2,4,5-trifluoroaniline has a molecular weight of 322.15 g/mol, XLogP of 4.54, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-bromothiophen-2-yl)methyl]-2,4,5-trifluoroaniline is sourced from PubChem (CID 57423164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).