About copper;21,22-dihydroporphyrin
copper;21,22-dihydroporphyrin (PubChem CID 57423943) has the molecular formula C20H14CuN4
and a molecular weight of 373.91 g/mol. Its IUPAC name is copper;21,22-dihydroporphyrin.
Molecular Properties
| Compound Name | copper;21,22-dihydroporphyrin |
| PubChem CID | 57423943 |
| Molecular Formula | C20H14CuN4 |
| Molecular Weight | 373.91 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | copper;21,22-dihydroporphyrin |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.[Cu] |
| InChI | InChI=1S/C20H14N4.Cu/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;/h1-12,21-22H;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-; |
| InChIKey | RDLGOPAEAZXYJQ-QDJBTJTOSA-N |
| XLogP | 4.65 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.91 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze copper;21,22-dihydroporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;21,22-dihydroporphyrin?
The IUPAC name of copper;21,22-dihydroporphyrin (CID 57423943) is copper;21,22-dihydroporphyrin.
What is the SMILES notation for copper;21,22-dihydroporphyrin?
The canonical SMILES for copper;21,22-dihydroporphyrin is C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.[Cu].
What is the InChIKey of copper;21,22-dihydroporphyrin?
The InChIKey is RDLGOPAEAZXYJQ-QDJBTJTOSA-N. The full InChI is InChI=1S/C20H14N4.Cu/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;/h1-12,21-22H;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;.
What are the key properties of copper;21,22-dihydroporphyrin?
copper;21,22-dihydroporphyrin has a molecular weight of 373.91 g/mol, XLogP of 4.65, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;21,22-dihydroporphyrin is sourced from PubChem (CID 57423943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).