C20H14N2O3 — CID 57424060
4-[1-(4-hydroxyphenyl)benzimidazol-2-yl]benzoic acid (PubChem CID 57424060) has the molecular formula C20H14N2O3 and a molecular weight of 330.34 g/mol. Its IUPAC name is 4-[1-(4-hydroxyphenyl)benzimidazol-2-yl]benzoic acid.
| Compound Name | 4-[1-(4-hydroxyphenyl)benzimidazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 57424060 |
| Molecular Formula | C20H14N2O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 4-[1-(4-hydroxyphenyl)benzimidazol-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nc3ccccc3n2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C20H14N2O3/c23-16-11-9-15(10-12-16)22-18-4-2-1-3-17(18)21-19(22)13-5-7-14(8-6-13)20(24)25/h1-12,23H,(H,24,25) |
| InChIKey | WZKZQVDULAMKJC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |