About pyridin-2-ylsulfanyl 5-[(4-fluorophenyl)methyl]furan-2-carboxylate
pyridin-2-ylsulfanyl 5-[(4-fluorophenyl)methyl]furan-2-carboxylate (PubChem CID 57424167) has the molecular formula C17H12FNO3S
and a molecular weight of 329.35 g/mol. Its IUPAC name is pyridin-2-ylsulfanyl 5-[(4-fluorophenyl)methyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | pyridin-2-ylsulfanyl 5-[(4-fluorophenyl)methyl]furan-2-carboxylate |
| PubChem CID | 57424167 |
| Molecular Formula | C17H12FNO3S |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | pyridin-2-ylsulfanyl 5-[(4-fluorophenyl)methyl]furan-2-carboxylate |
| SMILES | O=C(OSc1ccccn1)c1ccc(Cc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C17H12FNO3S/c18-13-6-4-12(5-7-13)11-14-8-9-15(21-14)17(20)22-23-16-3-1-2-10-19-16/h1-10H,11H2 |
| InChIKey | KYMSIPLJMRWYPR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze pyridin-2-ylsulfanyl 5-[(4-fluorophenyl)methyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylsulfanyl 5-[(4-fluorophenyl)methyl]furan-2-carboxylate?
The IUPAC name of pyridin-2-ylsulfanyl 5-[(4-fluorophenyl)methyl]furan-2-carboxylate (CID 57424167) is pyridin-2-ylsulfanyl 5-[(4-fluorophenyl)methyl]furan-2-carboxylate.
What is the SMILES notation for pyridin-2-ylsulfanyl 5-[(4-fluorophenyl)methyl]furan-2-carboxylate?
The canonical SMILES for pyridin-2-ylsulfanyl 5-[(4-fluorophenyl)methyl]furan-2-carboxylate is O=C(OSc1ccccn1)c1ccc(Cc2ccc(F)cc2)o1.
What is the InChIKey of pyridin-2-ylsulfanyl 5-[(4-fluorophenyl)methyl]furan-2-carboxylate?
The InChIKey is KYMSIPLJMRWYPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12FNO3S/c18-13-6-4-12(5-7-13)11-14-8-9-15(21-14)17(20)22-23-16-3-1-2-10-19-16/h1-10H,11H2.
What are the key properties of pyridin-2-ylsulfanyl 5-[(4-fluorophenyl)methyl]furan-2-carboxylate?
pyridin-2-ylsulfanyl 5-[(4-fluorophenyl)methyl]furan-2-carboxylate has a molecular weight of 329.35 g/mol, XLogP of 4.27, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylsulfanyl 5-[(4-fluorophenyl)methyl]furan-2-carboxylate is sourced from PubChem (CID 57424167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).