C14H19NO — CID 57425073
1,3,3,4,4-pentamethylquinolin-2-one (PubChem CID 57425073) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 1,3,3,4,4-pentamethylquinolin-2-one.
| Compound Name | 1,3,3,4,4-pentamethylquinolin-2-one |
|---|---|
| PubChem CID | 57425073 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1,3,3,4,4-pentamethylquinolin-2-one |
| SMILES | CN1C(=O)C(C)(C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C14H19NO/c1-13(2)10-8-6-7-9-11(10)15(5)12(16)14(13,3)4/h6-9H,1-5H3 |
| InChIKey | ZHQQVANLJMMNGW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |