About 4-(difluoromethoxy)-1,2-benzothiazol-3-one
4-(difluoromethoxy)-1,2-benzothiazol-3-one (PubChem CID 57425210) has the molecular formula C8H5F2NO2S
and a molecular weight of 217.20 g/mol. Its IUPAC name is 4-(difluoromethoxy)-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 4-(difluoromethoxy)-1,2-benzothiazol-3-one |
| PubChem CID | 57425210 |
| Molecular Formula | C8H5F2NO2S |
| Molecular Weight | 217.20 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | 4-(difluoromethoxy)-1,2-benzothiazol-3-one |
| SMILES | O=c1[nH]sc2cccc(OC(F)F)c12 |
| InChI | InChI=1S/C8H5F2NO2S/c9-8(10)13-4-2-1-3-5-6(4)7(12)11-14-5/h1-3,8H,(H,11,12) |
| InChIKey | GONFFFAZYJXECX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(difluoromethoxy)-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethoxy)-1,2-benzothiazol-3-one?
The IUPAC name of 4-(difluoromethoxy)-1,2-benzothiazol-3-one (CID 57425210) is 4-(difluoromethoxy)-1,2-benzothiazol-3-one.
What is the SMILES notation for 4-(difluoromethoxy)-1,2-benzothiazol-3-one?
The canonical SMILES for 4-(difluoromethoxy)-1,2-benzothiazol-3-one is O=c1[nH]sc2cccc(OC(F)F)c12.
What is the InChIKey of 4-(difluoromethoxy)-1,2-benzothiazol-3-one?
The InChIKey is GONFFFAZYJXECX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F2NO2S/c9-8(10)13-4-2-1-3-5-6(4)7(12)11-14-5/h1-3,8H,(H,11,12).
What are the key properties of 4-(difluoromethoxy)-1,2-benzothiazol-3-one?
4-(difluoromethoxy)-1,2-benzothiazol-3-one has a molecular weight of 217.20 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethoxy)-1,2-benzothiazol-3-one is sourced from PubChem (CID 57425210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).