C6H6F5NO2S — CID 57425691
2-(3,3,4,4,4-pentafluorobutylsulfonyl)acetonitrile (PubChem CID 57425691) has the molecular formula C6H6F5NO2S and a molecular weight of 251.18 g/mol. Its IUPAC name is 2-(3,3,4,4,4-pentafluorobutylsulfonyl)acetonitrile.
| Compound Name | 2-(3,3,4,4,4-pentafluorobutylsulfonyl)acetonitrile |
|---|---|
| PubChem CID | 57425691 |
| Molecular Formula | C6H6F5NO2S |
| Molecular Weight | 251.18 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 2-(3,3,4,4,4-pentafluorobutylsulfonyl)acetonitrile |
| SMILES | N#CCS(=O)(=O)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H6F5NO2S/c7-5(8,6(9,10)11)1-3-15(13,14)4-2-12/h1,3-4H2 |
| InChIKey | FGFIOLHGIPHUFK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|