About 2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol
2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol (PubChem CID 57425700) has the molecular formula C18H15FN2O
and a molecular weight of 294.33 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol |
| PubChem CID | 57425700 |
| Molecular Formula | C18H15FN2O |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol |
| SMILES | OC(Cc1ccc(F)cc1)(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C18H15FN2O/c19-17-7-5-14(6-8-17)11-18(22,15-3-1-9-20-12-15)16-4-2-10-21-13-16/h1-10,12-13,22H,11H2 |
| InChIKey | FBHHKKJIWDRXOR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol?
The IUPAC name of 2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol (CID 57425700) is 2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol.
What is the SMILES notation for 2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol?
The canonical SMILES for 2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol is OC(Cc1ccc(F)cc1)(c1cccnc1)c1cccnc1.
What is the InChIKey of 2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol?
The InChIKey is FBHHKKJIWDRXOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15FN2O/c19-17-7-5-14(6-8-17)11-18(22,15-3-1-9-20-12-15)16-4-2-10-21-13-16/h1-10,12-13,22H,11H2.
What are the key properties of 2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol?
2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol has a molecular weight of 294.33 g/mol, XLogP of 3.09, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-1,1-dipyridin-3-ylethanol is sourced from PubChem (CID 57425700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).