methyl 2-(3,3,3-trifluoropropylsulfonyl)acetate

C6H9F3O4S — CID 57425720

IUPACmethyl 2-(3,3,3-trifluoropropylsulfonyl)acetate
SMILESCOC(=O)CS(=O)(=O)CCC(F)(F)F
InChIInChI=1S/C6H9F3O4S/c1-13-5(10)4-14(11,12)3-2-6(7,8)9/h2-4H2,1H3
InChIKeyBJRVZBCUMPLDKC-UHFFFAOYSA-N
MW234.19 g/mol
LogP0.53
Rot. Bonds4

About methyl 2-(3,3,3-trifluoropropylsulfonyl)acetate

methyl 2-(3,3,3-trifluoropropylsulfonyl)acetate (PubChem CID 57425720) has the molecular formula C6H9F3O4S and a molecular weight of 234.19 g/mol. Its IUPAC name is methyl 2-(3,3,3-trifluoropropylsulfonyl)acetate.

Molecular Properties

Compound Namemethyl 2-(3,3,3-trifluoropropylsulfonyl)acetate
PubChem CID57425720
Molecular FormulaC6H9F3O4S
Molecular Weight234.19 g/mol
Exact Mass234.02
IUPAC Namemethyl 2-(3,3,3-trifluoropropylsulfonyl)acetate
SMILESCOC(=O)CS(=O)(=O)CCC(F)(F)F
InChIInChI=1S/C6H9F3O4S/c1-13-5(10)4-14(11,12)3-2-6(7,8)9/h2-4H2,1H3
InChIKeyBJRVZBCUMPLDKC-UHFFFAOYSA-N
XLogP0.53
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.19
LogP ≤ 50.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(3,3,3-trifluoropropylsulfonyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3,3,3-trifluoropropylsulfonyl)acetate?
The IUPAC name of methyl 2-(3,3,3-trifluoropropylsulfonyl)acetate (CID 57425720) is methyl 2-(3,3,3-trifluoropropylsulfonyl)acetate.
What is the SMILES notation for methyl 2-(3,3,3-trifluoropropylsulfonyl)acetate?
The canonical SMILES for methyl 2-(3,3,3-trifluoropropylsulfonyl)acetate is COC(=O)CS(=O)(=O)CCC(F)(F)F.
What is the InChIKey of methyl 2-(3,3,3-trifluoropropylsulfonyl)acetate?
The InChIKey is BJRVZBCUMPLDKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F3O4S/c1-13-5(10)4-14(11,12)3-2-6(7,8)9/h2-4H2,1H3.
What are the key properties of methyl 2-(3,3,3-trifluoropropylsulfonyl)acetate?
methyl 2-(3,3,3-trifluoropropylsulfonyl)acetate has a molecular weight of 234.19 g/mol, XLogP of 0.53, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,3,3-trifluoropropylsulfonyl)acetate is sourced from PubChem (CID 57425720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).