C17H12BrN3O — CID 57425783
1-(6-bromo-2-pyridinyl)-2,2-dipyridin-3-ylethanone (PubChem CID 57425783) has the molecular formula C17H12BrN3O and a molecular weight of 354.21 g/mol. Its IUPAC name is 1-(6-bromo-2-pyridinyl)-2,2-dipyridin-3-ylethanone.
| Compound Name | 1-(6-bromo-2-pyridinyl)-2,2-dipyridin-3-ylethanone |
|---|---|
| PubChem CID | 57425783 |
| Molecular Formula | C17H12BrN3O |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 1-(6-bromo-2-pyridinyl)-2,2-dipyridin-3-ylethanone |
| SMILES | O=C(c1cccc(Br)n1)C(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C17H12BrN3O/c18-15-7-1-6-14(21-15)17(22)16(12-4-2-8-19-10-12)13-5-3-9-20-11-13/h1-11,16H |
| InChIKey | FMDXCTMWUVIHCL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|