C10H12F8O2S — CID 57425792
methyl 5,5,6,6,6-pentafluoro-2-(3,3,3-trifluoropropylsulfanyl)hexanoate (PubChem CID 57425792) has the molecular formula C10H12F8O2S and a molecular weight of 348.26 g/mol. Its IUPAC name is methyl 5,5,6,6,6-pentafluoro-2-(3,3,3-trifluoropropylsulfanyl)hexanoate.
| Compound Name | methyl 5,5,6,6,6-pentafluoro-2-(3,3,3-trifluoropropylsulfanyl)hexanoate |
|---|---|
| PubChem CID | 57425792 |
| Molecular Formula | C10H12F8O2S |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | methyl 5,5,6,6,6-pentafluoro-2-(3,3,3-trifluoropropylsulfanyl)hexanoate |
| SMILES | COC(=O)C(CCC(F)(F)C(F)(F)F)SCCC(F)(F)F |
| InChI | InChI=1S/C10H12F8O2S/c1-20-7(19)6(21-5-4-9(13,14)15)2-3-8(11,12)10(16,17)18/h6H,2-5H2,1H3 |
| InChIKey | PXAVPYAXBKPSPG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|